ChemNet > CAS > 54745-92-5 2-quinoxaloyl chloride
54745-92-5 2-quinoxaloyl chloride
| Nome do produto |
2-quinoxaloyl chloride |
| Sinônimos |
2-Quinoxalinecarbonyl chloride; quinoxaline-2-carbonyl chloride |
| Fórmula molecular |
C9H5ClN2O |
| Peso Molecular |
192.6018 |
| InChI |
InChI=1/C9H5ClN2O/c10-9(13)8-5-11-6-3-1-2-4-7(6)12-8/h1-5H |
| CAS Registry Number |
54745-92-5 |
| EINECS |
259-315-9 |
| Estrutura Molecular |
|
| Densidade |
1.411g/cm3 |
| Ponto de fusão |
113℃ |
| Ponto de ebulição |
324.4°C at 760 mmHg |
| índice de refração |
1.662 |
| O ponto de inflamação |
150°C |
| Símbolos de perigo |
 C:Corrosive;
|
| Códigos de risco |
R34:Causes burns.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
