ChemNet > CAS > 548-39-0 Perinaphthenone
548-39-0 Perinaphthenone
| Nome do produto |
Perinaphthenone |
| Sinônimos |
phenalen-1-one; Perinaphthalenone; 1H-phenalen-1-one |
| Fórmula molecular |
C13H8O |
| Peso Molecular |
180.202 |
| InChI |
InChI=1/C13H8O/c14-12-8-7-10-4-1-3-9-5-2-6-11(12)13(9)10/h1-8H |
| CAS Registry Number |
548-39-0 |
| EINECS |
208-945-2 |
| Estrutura Molecular |
|
| Densidade |
1.265g/cm3 |
| Ponto de fusão |
149-154℃ |
| Ponto de ebulição |
355.2°C at 760 mmHg |
| índice de refração |
1.715 |
| O ponto de inflamação |
157.9°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
