ChemNet > CAS > 573-03-5 4-fluoro-1-naphthoic acid
573-03-5 4-fluoro-1-naphthoic acid
| Nome do produto |
4-fluoro-1-naphthoic acid |
| Sinônimos |
4-Fluoro-1-naphthoic acid; 4-fluoronaphthalene-1-carboxylic acid; 4-fluoronaphthalene-1-carboxylate; 4-Fluoro-1-naphthoicacid |
| Fórmula molecular |
C11H6FO2 |
| Peso Molecular |
189.1631 |
| InChI |
InChI=1/C11H7FO2/c12-10-6-5-9(11(13)14)7-3-1-2-4-8(7)10/h1-6H,(H,13,14)/p-1 |
| CAS Registry Number |
573-03-5 |
| EINECS |
209-346-9 |
| Estrutura Molecular |
|
| Ponto de fusão |
223-227℃ |
| Ponto de ebulição |
370.8°C at 760 mmHg |
| O ponto de inflamação |
178°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
