ChemNet > CAS > 58157-89-4 1-(5-nitro-3-thienyl)ethan-1-one
58157-89-4 1-(5-nitro-3-thienyl)ethan-1-one
| Nome do produto |
1-(5-nitro-3-thienyl)ethan-1-one |
| Sinônimos |
4-Acetyl-2-nitrothiophene; 1-(5-nitrothiophen-3-yl)ethanone |
| Fórmula molecular |
C6H5NO3S |
| Peso Molecular |
171.1738 |
| InChI |
InChI=1/C6H5NO3S/c1-4(8)5-2-6(7(9)10)11-3-5/h2-3H,1H3 |
| CAS Registry Number |
58157-89-4 |
| Estrutura Molecular |
|
| Densidade |
1.399g/cm3 |
| Ponto de fusão |
59℃ |
| Ponto de ebulição |
247.9°C at 760 mmHg |
| índice de refração |
1.589 |
| O ponto de inflamação |
103.7°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
