ChemNet > CAS > 608-28-6 2-Iodo-m-xylene
608-28-6 2-Iodo-m-xylene
| Nome do produto |
2-Iodo-m-xylene |
| Sinônimos |
2-Iodo-1,3-Dimethylbenzene |
| Fórmula molecular |
C8H9I |
| Peso Molecular |
232.0615 |
| InChI |
InChI=1/C8H9I/c1-6-4-3-5-7(2)8(6)9/h3-5H,1-2H3 |
| CAS Registry Number |
608-28-6 |
| EINECS |
210-158-4 |
| Estrutura Molecular |
|
| Densidade |
1.61g/cm3 |
| Ponto de ebulição |
227.5°C at 760 mmHg |
| índice de refração |
1.592 |
| O ponto de inflamação |
98.1°C |
| solubilidade em água |
insoluble |
| Símbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection;
|
|
