ChemNet > CAS > 632-22-4 1,1,3,3-Tetramethylurea
632-22-4 1,1,3,3-Tetramethylurea
| Nome do produto |
1,1,3,3-Tetramethylurea |
| Sinônimos |
Tetramethylurea |
| Fórmula molecular |
C5H12N2O |
| Peso Molecular |
116.16 |
| InChI |
InChI=1/C5H12N2O/c1-6(2)5(8)7(3)4/h1-4H3 |
| CAS Registry Number |
632-22-4 |
| EINECS |
211-173-9 |
| Estrutura Molecular |
|
| Densidade |
0.9879 |
| Ponto de fusão |
-1℃ |
| Ponto de ebulição |
174-178℃ |
| índice de refração |
1.4496-1.4516 |
| O ponto de inflamação |
65℃ |
| solubilidade em água |
miscible |
| Símbolos de perigo |
 Xn:Harmful;
|
| Códigos de risco |
R22:;
|
| Descrição da Segurança |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
