ChemNet > CAS > 6336-58-9 3-Dibutylamino-1-propyne
6336-58-9 3-Dibutylamino-1-propyne
| Nome do produto |
3-Dibutylamino-1-propyne |
| Sinônimos |
N-butyl-N-(prop-2-yn-1-yl)butan-1-amine |
| Fórmula molecular |
C11H21N |
| Peso Molecular |
167.2911 |
| InChI |
InChI=1/C11H21N/c1-4-7-10-12(9-6-3)11-8-5-2/h3H,4-5,7-11H2,1-2H3 |
| CAS Registry Number |
6336-58-9 |
| Estrutura Molecular |
|
| Densidade |
0.831g/cm3 |
| Ponto de ebulição |
224.4°C at 760 mmHg |
| índice de refração |
1.454 |
| O ponto de inflamação |
81.4°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/38:Irritating to eyes and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
