CAS No: 638-17-5, Chemical Name: 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine
the physical and chemical property of 638-17-5, 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine is provided by ChemNet.com
ChemNet > CAS > 638-17-5 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine
638-17-5 5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine
| Nome do produto |
5,6-dihydro-2,4,6-trimethyl-1,3,5-dithiazine |
| Sinônimos |
2,4,6-trimethyl-1,3,5-dithiazinane; 2,4,6-Trimethyl-1,3,5-dithiazine |
| Fórmula molecular |
C6H13NS2 |
| Peso Molecular |
163.3041 |
| InChI |
InChI=1/C6H13NS2/c1-4-7-5(2)9-6(3)8-4/h4-7H,1-3H3 |
| CAS Registry Number |
638-17-5 |
| EINECS |
211-323-3 |
| Estrutura Molecular |
|
| Densidade |
1.011g/cm3 |
| Ponto de ebulição |
260.7°C at 760 mmHg |
| índice de refração |
1.501 |
| O ponto de inflamação |
111.5°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
|
|
