ChemNet > CAS > 6484-25-9 4-Chloro-2-phenylquinazoline
6484-25-9 4-Chloro-2-phenylquinazoline
| Nome do produto |
4-Chloro-2-phenylquinazoline |
| Sinônimos |
AM-ex-OL |
| Fórmula molecular |
C14H9ClN2 |
| Peso Molecular |
240.6877 |
| InChI |
InChI=1/C14H9ClN2/c15-13-11-8-4-5-9-12(11)16-14(17-13)10-6-2-1-3-7-10/h1-9H |
| CAS Registry Number |
6484-25-9 |
| EINECS |
229-346-2 |
| Estrutura Molecular |
|
| Densidade |
1.285g/cm3 |
| Ponto de fusão |
123-128℃ |
| Ponto de ebulição |
301.2°C at 760 mmHg |
| índice de refração |
1.667 |
| O ponto de inflamação |
164.4°C |
| Símbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
