ChemNet > CAS > 6972-51-6 2,5-Dimethylphenethylalcohol
6972-51-6 2,5-Dimethylphenethylalcohol
| Nome do produto |
2,5-Dimethylphenethylalcohol |
| Sinônimos |
2,5-Dimethylphenethyl alcohol; 2-(2,5-dimethylphenyl)ethanol |
| Fórmula molecular |
C10H14O |
| Peso Molecular |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-8-3-4-9(2)10(7-8)5-6-11/h3-4,7,11H,5-6H2,1-2H3 |
| CAS Registry Number |
6972-51-6 |
| Estrutura Molecular |
|
| Densidade |
0.986g/cm3 |
| Ponto de ebulição |
267.6°C at 760 mmHg |
| índice de refração |
1.529 |
| O ponto de inflamação |
126°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
