ChemNet > CAS > 698-90-8 cyclohexylurea
698-90-8 cyclohexylurea
| Nome do produto |
cyclohexylurea |
| Sinônimos |
N-CYCLOHEXLUREA; 1-Cyclohexylurea; N-Cyclohexylurea; Cyclohexyl-ure |
| Fórmula molecular |
C7H14N2O |
| Peso Molecular |
142.1989 |
| InChI |
InChI=1/C7H14N2O/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H3,8,9,10) |
| CAS Registry Number |
698-90-8 |
| EINECS |
211-822-6 |
| Estrutura Molecular |
|
| Densidade |
1.05g/cm3 |
| Ponto de ebulição |
240.3°C at 760 mmHg |
| índice de refração |
1.5 |
| O ponto de inflamação |
99.2°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
