ChemNet > CAS > 7152-04-7 4-Acetamidocinnamic acid
7152-04-7 4-Acetamidocinnamic acid
| Nome do produto |
4-Acetamidocinnamic acid |
| Sinônimos |
(2E)-3-[4-(acetylamino)phenyl]prop-2-enoic acid |
| Fórmula molecular |
C11H11NO3 |
| Peso Molecular |
205.2099 |
| InChI |
InChI=1/C11H11NO3/c1-8(13)12-10-5-2-9(3-6-10)4-7-11(14)15/h2-7H,1H3,(H,12,13)(H,14,15)/b7-4+ |
| CAS Registry Number |
7152-04-7 |
| Estrutura Molecular |
|
| Densidade |
1.297g/cm3 |
| Ponto de ebulição |
470.9°C at 760 mmHg |
| índice de refração |
1.654 |
| O ponto de inflamação |
238.6°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
