ChemNet > CAS > 7152-24-1 2-(Methylmercapto)benzimidazole
7152-24-1 2-(Methylmercapto)benzimidazole
| Nome do produto |
2-(Methylmercapto)benzimidazole |
| Sinônimos |
2-(Methylthio)benzimidazole; 2-(methylsulfanyl)-1H-benzimidazole |
| Fórmula molecular |
C8H8N2S |
| Peso Molecular |
164.2275 |
| InChI |
InChI=1/C8H8N2S/c1-11-8-9-6-4-2-3-5-7(6)10-8/h2-5H,1H3,(H,9,10) |
| CAS Registry Number |
7152-24-1 |
| EINECS |
230-494-5 |
| Estrutura Molecular |
|
| Densidade |
1.29g/cm3 |
| Ponto de fusão |
202-205℃ |
| Ponto de ebulição |
347.2°C at 760 mmHg |
| índice de refração |
1.691 |
| O ponto de inflamação |
163.8°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
