ChemNet > CAS > 7355-58-0 N-(2-Chloroethyl)acetamide
7355-58-0 N-(2-Chloroethyl)acetamide
| Nome do produto |
N-(2-Chloroethyl)acetamide |
| Sinônimos |
Acetamide, N-(2-chloroethyl)-; 4-04-00-00449 (Beilstein Handbook Reference); AI3-08685; BRN 1743108; NSC 30247 |
| Fórmula molecular |
C4H8ClNO |
| Peso Molecular |
121.5654 |
| InChI |
InChI=1/C4H8ClNO/c1-4(7)6-3-2-5/h2-3H2,1H3,(H,6,7) |
| CAS Registry Number |
7355-58-0 |
| EINECS |
230-884-5 |
| Estrutura Molecular |
|
| Densidade |
1.086g/cm3 |
| Ponto de ebulição |
275.6°C at 760 mmHg |
| índice de refração |
1.432 |
| O ponto de inflamação |
120.4°C |
| Símbolos de perigo |
 Xn:Harmful;
|
| Códigos de risco |
R33:Danger of cummulative effects.;
|
| Descrição da Segurança |
S24/25:Avoid contact with skin and eyes.;
|
|
