ChemNet > CAS > 7745-92-8 2-Iodo-4-nitrotoluene
7745-92-8 2-Iodo-4-nitrotoluene
| Nome do produto |
2-Iodo-4-nitrotoluene |
| Sinônimos |
1-Nitro-3-iodo-4-methylbenzene |
| Fórmula molecular |
C7H6INO2 |
| Peso Molecular |
263.03 |
| InChI |
InChI=1/C7H6INO2/c1-5-2-3-6(9(10)11)4-7(5)8/h2-4H,1H3 |
| CAS Registry Number |
7745-92-8 |
| EINECS |
231-808-3 |
| Estrutura Molecular |
|
| Ponto de fusão |
60-62℃ |
| Ponto de ebulição |
164-165℃(15 torr) |
| Símbolos de perigo |
 Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
