ChemNet > CAS > 78686-87-0 2,5-dichloropyridine-3-carbonyl chloride
78686-87-0 2,5-dichloropyridine-3-carbonyl chloride
| Nome do produto |
2,5-dichloropyridine-3-carbonyl chloride |
| Fórmula molecular |
C6H2Cl3NO |
| Peso Molecular |
210.4452 |
| InChI |
InChI=1/C6H2Cl3NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H |
| CAS Registry Number |
78686-87-0 |
| Estrutura Molecular |
|
| Densidade |
1.582g/cm3 |
| Ponto de ebulição |
269°C at 760 mmHg |
| índice de refração |
1.582 |
| O ponto de inflamação |
116.5°C |
| Símbolos de perigo |
 C:Corrosive;
|
| Códigos de risco |
R34:Causes burns.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
