ChemNet > CAS > 81452-54-2 Methyl 3-methylthiophene-2-carboxylate
81452-54-2 Methyl 3-methylthiophene-2-carboxylate
| Nome do produto |
Methyl 3-methylthiophene-2-carboxylate |
| Sinônimos |
3-Methylthiophene-2-carboxylic acid methyl ester; Methyl-3-methylthiophene-2-carboxylate |
| Fórmula molecular |
C7H8O2S |
| Peso Molecular |
156.2022 |
| InChI |
InChI=1/C7H8O2S/c1-5-3-4-10-6(5)7(8)9-2/h3-4H,1-2H3 |
| CAS Registry Number |
81452-54-2 |
| Estrutura Molecular |
|
| Densidade |
1.173g/cm3 |
| Ponto de ebulição |
211°C at 760 mmHg |
| índice de refração |
1.531 |
| O ponto de inflamação |
81.4°C |
| Símbolos de perigo |
|
| Códigos de risco |
|
| Descrição da Segurança |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
