ChemNet > CAS > 92-24-0 2,3-Benzanthracene
92-24-0 2,3-Benzanthracene
| Nome do produto |
2,3-Benzanthracene |
| Sinônimos |
NAPHTHACENE; Chrysogen; LT-S940; Tetracene |
| Fórmula molecular |
C18H12 |
| Peso Molecular |
228.2879 |
| InChI |
InChI=1/C18H12/c1-2-6-14-10-18-12-16-8-4-3-7-15(16)11-17(18)9-13(14)5-1/h1-12H |
| CAS Registry Number |
92-24-0 |
| EINECS |
202-138-9 |
| Estrutura Molecular |
|
| Densidade |
1.19g/cm3 |
| Ponto de fusão |
300℃ |
| Ponto de ebulição |
436.7°C at 760 mmHg |
| índice de refração |
1.771 |
| O ponto de inflamação |
209.1°C |
| Símbolos de perigo |
 Xn:Harmful;
|
| Códigos de risco |
R40:Possible risks of irreversible effects.;
|
| Descrição da Segurança |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
