ChemNet > CAS > 97914-59-5 2-(Difluoromethoxy)benzoic acid
97914-59-5 2-(Difluoromethoxy)benzoic acid
| Nome do produto |
2-(Difluoromethoxy)benzoic acid |
| Sinônimos |
2-(Difluorometoxy)benzoic acid; 2-(difluoromethoxy)benzoate |
| Fórmula molecular |
C8H6F2O3 |
| Peso Molecular |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-8(10)13-6-4-2-1-3-5(6)7(11)12/h1-4,8H,(H,11,12) |
| CAS Registry Number |
97914-59-5 |
| Estrutura Molecular |
|
| Densidade |
1.37g/cm3 |
| Ponto de ebulição |
273.6°C at 760 mmHg |
| índice de refração |
1.496 |
| O ponto de inflamação |
119.3°C |
| Símbolos de perigo |
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descrição da Segurança |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
