ChemNet > CAS > 100-80-1 m-Vinyltoluene
100-80-1 m-Vinyltoluene
| Название продукта |
m-Vinyltoluene |
| Синонимы |
3-Methylstyrene; 3-Vinyltoluene |
| Молекулярная формула |
C9H10 |
| Молекулярный вес |
118.17 |
| InChI |
InChI=1/C9H10/c1-3-9-6-4-5-8(2)7-9/h3-7H,1H2,2H3 |
| Регистрационный номер CAS |
100-80-1 |
| EINECS |
202-889-2 |
| Молекулярная структура |
|
| Плотность |
170 |
| Точка кипения |
171℃ |
| Символы опасности |
|
| Риск коды |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
