ChemNet > CAS > 10074-13-2 2,4,6-trimethyl-1,3-benzenedimethanethiol
10074-13-2 2,4,6-trimethyl-1,3-benzenedimethanethiol
| Название продукта |
2,4,6-trimethyl-1,3-benzenedimethanethiol |
| Синонимы |
2,4-Bis-(mercaptomethyl)-mesitylene; [3-(Mercaptomethyl)-2,4,6-trimethylphenyl]methanethiol; (2,4,6-trimethylbenzene-1,3-diyl)dimethanethiol |
| Молекулярная формула |
C11H16S2 |
| Молекулярный вес |
212.3747 |
| InChI |
InChI=1/C11H16S2/c1-7-4-8(2)11(6-13)9(3)10(7)5-12/h4,12-13H,5-6H2,1-3H3 |
| Регистрационный номер CAS |
10074-13-2 |
| Молекулярная структура |
|
| Плотность |
1.067g/cm3 |
| Температура плавления |
67-68℃ |
| Точка кипения |
342.9°C at 760 mmHg |
| Показатель преломления |
1.581 |
| Температура вспышки |
142.3°C |
| Символы опасности |
 Xi:Irritant;
|
| Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
