CAS No: 103548-82-9, Chemical Name: Huperzine B
Chemical CAS Database with Global Chemical Suppliers - ChemNet

Updated CAS

the physical and chemical property of 103548-82-9, Huperzine B is provided by

  ChemNet > CAS > 103548-82-9 Huperzine B

103548-82-9 Huperzine B

Название продукта Huperzine B
Синонимы HuperzineB; 12-Methyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-prop[1]eno-1,7-phenanthrolin-8(7H)-one; (4aR,5S,10bR)-12-methyl-2,3,4,4a,5,6-hexahydro-1H-5,10b-prop[1]eno-1,7-phenanthrolin-8(7H)-one
Молекулярная формула C16H20N2O
Молекулярный вес 256.3428
InChI InChI=1/C16H20N2O/c1-10-7-11-8-14-13(4-5-15(19)18-14)16(9-10)12(11)3-2-6-17-16/h4-5,7,11-12,17H,2-3,6,8-9H2,1H3,(H,18,19)/t11-,12+,16-/m0/s1
Регистрационный номер CAS 103548-82-9
Молекулярная структура 103548-82-9 Huperzine B
Плотность 1.21g/cm3
Точка кипения 533.5°C at 760 mmHg
Показатель преломления 1.623
Температура вспышки 216.4°C
Символы опасности
Риск коды
Характеристики безопасности