ChemNet > CAS > 13388-75-5 3,5-Dimethoxyphenylacetonitrile
13388-75-5 3,5-Dimethoxyphenylacetonitrile
| Название продукта |
3,5-Dimethoxyphenylacetonitrile |
| Молекулярная формула |
C10H11NO2 |
| Молекулярный вес |
177.1998 |
| InChI |
InChI=1/C10H11NO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3H2,1-2H3 |
| Регистрационный номер CAS |
13388-75-5 |
| EINECS |
202-225-1 |
| Молекулярная структура |
|
| Плотность |
1.082g/cm3 |
| Точка кипения |
316.7°C at 760 mmHg |
| Показатель преломления |
1.511 |
| Температура вспышки |
127.3°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
