ChemNet > CAS > 13388-75-5 3,5-Dimethoxyphenylacetonitrile
13388-75-5 3,5-Dimethoxyphenylacetonitrile
Название продукта |
3,5-Dimethoxyphenylacetonitrile |
Молекулярная формула |
C10H11NO2 |
Молекулярный вес |
177.1998 |
InChI |
InChI=1/C10H11NO2/c1-12-9-5-8(3-4-11)6-10(7-9)13-2/h5-7H,3H2,1-2H3 |
Регистрационный номер CAS |
13388-75-5 |
EINECS |
202-225-1 |
Молекулярная структура |
|
Плотность |
1.082g/cm3 |
Точка кипения |
316.7°C at 760 mmHg |
Показатель преломления |
1.511 |
Температура вспышки |
127.3°C |
Символы опасности |
|
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|