ChemNet > CAS > 13888-77-2 (pentafluorophenyl)dimethylsilane
13888-77-2 (pentafluorophenyl)dimethylsilane
Название продукта |
(pentafluorophenyl)dimethylsilane |
Синонимы |
Dimethyl(pentafluorophenyl)silane |
Молекулярная формула |
C8H7F5Si |
Молекулярный вес |
226.2187 |
InChI |
InChI=1/C8H7F5Si/c1-14(2)8-6(12)4(10)3(9)5(11)7(8)13/h14H,1-2H3 |
Регистрационный номер CAS |
13888-77-2 |
Молекулярная структура |
|
Точка кипения |
163.8°C at 760 mmHg |
Температура вспышки |
40.6°C |
Символы опасности |
|
Риск коды |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|