ChemNet > CAS > 145689-34-5 2,3-difluorophenylacetonitrile
145689-34-5 2,3-difluorophenylacetonitrile
| Название продукта |
2,3-difluorophenylacetonitrile |
| Синонимы |
2,3-Difluorobenzylcyanide; 2,3-difluorophenylacetanitrile |
| Молекулярная формула |
C8H5F2N |
| Молекулярный вес |
153.1288 |
| InChI |
InChI=1/C8H5F2N/c9-7-3-1-2-6(4-5-11)8(7)10/h1-3H,4H2 |
| Регистрационный номер CAS |
145689-34-5 |
| Молекулярная структура |
|
| Плотность |
1.234g/cm3 |
| Точка кипения |
216.9°C at 760 mmHg |
| Показатель преломления |
1.487 |
| Температура вспышки |
85°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
