ChemNet > CAS > 16493-04-2 3-butoxycyclohex-2-en-1-one
16493-04-2 3-butoxycyclohex-2-en-1-one
| Название продукта |
3-butoxycyclohex-2-en-1-one |
| Синонимы |
3-Butoxycyclohex-2-en-1-one; AI3-08102; 2-Cyclohexen-1-one, 3-butoxy- |
| Молекулярная формула |
C10H16O2 |
| Молекулярный вес |
168.2328 |
| InChI |
InChI=1/C10H16O2/c1-2-3-7-12-10-6-4-5-9(11)8-10/h8H,2-7H2,1H3 |
| Регистрационный номер CAS |
16493-04-2 |
| EINECS |
240-557-9 |
| Молекулярная структура |
|
| Плотность |
0.97g/cm3 |
| Точка кипения |
280.6°C at 760 mmHg |
| Показатель преломления |
1.468 |
| Температура вспышки |
121.1°C |
| Символы опасности |
 Xn:Harmful;
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S36/37:Wear suitable protective clothing and gloves.;
|
|
