ChemNet > CAS > 16518-62-0 3-Bromo-N,N-dimethylaniline
16518-62-0 3-Bromo-N,N-dimethylaniline
| Название продукта |
3-Bromo-N,N-dimethylaniline |
| Синонимы |
Benzenamine, 3-bromo-N,N-dimethyl-; 4-cyanophenyl benzoate; 3-bromo-N,N-dimethylbenzenamine |
| Молекулярная формула |
C8H10BrN |
| Молекулярный вес |
200.0757 |
| InChI |
InChI=1/C8H10BrN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| Регистрационный номер CAS |
16518-62-0 |
| Молекулярная структура |
|
| Плотность |
1.393g/cm3 |
| Точка кипения |
259.7°C at 760 mmHg |
| Показатель преломления |
1.586 |
| Температура вспышки |
110.8°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Характеристики безопасности |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
