ChemNet > CAS > 175204-60-1 4-(ethylthio)-6-isopropyl-1,3,5-triazin-2-amine
175204-60-1 4-(ethylthio)-6-isopropyl-1,3,5-triazin-2-amine
Название продукта |
4-(ethylthio)-6-isopropyl-1,3,5-triazin-2-amine |
Синонимы |
4-(ethylsulfanyl)-6-(1-methylethyl)-1,3,5-triazin-2-amine |
Молекулярная формула |
C8H14N4S |
Молекулярный вес |
198.2886 |
InChI |
InChI=1/C8H14N4S/c1-4-13-8-11-6(5(2)3)10-7(9)12-8/h5H,4H2,1-3H3,(H2,9,10,11,12) |
Регистрационный номер CAS |
175204-60-1 |
Молекулярная структура |
|
Плотность |
1.17g/cm3 |
Температура плавления |
114℃ |
Точка кипения |
404.7°C at 760 mmHg |
Показатель преломления |
1.565 |
Температура вспышки |
198.6°C |
Символы опасности |
Xi:Irritant;
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|