ChemNet > CAS > 18362-64-6 2,6-Dimethyl-3,5-heptanedione
18362-64-6 2,6-Dimethyl-3,5-heptanedione
Название продукта |
2,6-Dimethyl-3,5-heptanedione |
Синонимы |
2,6-dimethylheptane-3,5-dione; (4Z)-5-hydroxy-2,6-dimethylhept-4-en-3-one |
Молекулярная формула |
C9H16O2 |
Молекулярный вес |
156.2221 |
InChI |
InChI=1/C9H16O2/c1-6(2)8(10)5-9(11)7(3)4/h5-7,10H,1-4H3/b8-5- |
Регистрационный номер CAS |
18362-64-6 |
EINECS |
242-234-8 |
Молекулярная структура |
|
Плотность |
0.941g/cm3 |
Точка кипения |
239.2°C at 760 mmHg |
Показатель преломления |
1.456 |
Температура вспышки |
97.8°C |
Символы опасности |
Xi:Irritant;
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|