ChemNet > CAS > 18708-70-8 2,4,6-Trichloronitro Benzene
18708-70-8 2,4,6-Trichloronitro Benzene
| Название продукта |
2,4,6-Trichloronitro Benzene |
| Синонимы |
2-Nitro-1,3,5-trichlorobenzene; 2,4,6-Trichloronitrobenzene; 1,3,5-trichloro-2-nitrobenzene |
| Молекулярная формула |
C6H2Cl3NO2 |
| Молекулярный вес |
226.4446 |
| InChI |
InChI=1/C6H2Cl3NO2/c7-3-1-4(8)6(10(11)12)5(9)2-3/h1-2H |
| Регистрационный номер CAS |
18708-70-8 |
| EINECS |
242-518-1 |
| Молекулярная структура |
|
| Плотность |
1.651g/cm3 |
| Температура плавления |
70-72℃ |
| Точка кипения |
303.2°C at 760 mmHg |
| Показатель преломления |
1.609 |
| Температура вспышки |
137.2°C |
| Символы опасности |
|
| Риск коды |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R33:Danger of cummulative effects.;
|
| Характеристики безопасности |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
