ChemNet > CAS > 19353-92-5 4-Dimethylaminobenzhydrazide
19353-92-5 4-Dimethylaminobenzhydrazide
Название продукта |
4-Dimethylaminobenzhydrazide |
Синонимы |
4-(Dimethylamino)-benzoylhydrazine; LABOTEST-BB LT00454413; 4-DIMETHYLAMINO-BENZOIC ACID HYDRAZIDE; 4-(DIMETHYLAMINO)BENZENE-1-CARBOHYDRAZIDE; 4-(N,N-DIMETHYLAMINO)BENZHYDRAZIDE; AKOS BC-1518; 4-Dimethylaminobenzohydrazide; Benzoic acid, 4-(dimethylamino)-, hydrazide; 3-(dimethylamino)benzohydrazide |
Молекулярная формула |
C9H13N3O |
Молекулярный вес |
179.219 |
InChI |
InChI=1/C9H13N3O/c1-12(2)8-5-3-4-7(6-8)9(13)11-10/h3-6H,10H2,1-2H3,(H,11,13) |
Регистрационный номер CAS |
19353-92-5 |
EINECS |
242-985-1 |
Молекулярная структура |
|
Плотность |
1.156g/cm3 |
Температура плавления |
172-173℃ |
Показатель преломления |
1.601 |
Символы опасности |
Xi:;
|
Риск коды |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|