ChemNet > CAS > 21398-64-1 N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine
21398-64-1 N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine
| Название продукта |
N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)-N-isopropylamine |
| Синонимы |
N-(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)propan-2-amine |
| Молекулярная формула |
C12H17NO2 |
| Молекулярный вес |
207.2689 |
| InChI |
InChI=1/C12H17NO2/c1-9(2)13-7-10-8-14-11-5-3-4-6-12(11)15-10/h3-6,9-10,13H,7-8H2,1-2H3 |
| Регистрационный номер CAS |
21398-64-1 |
| Молекулярная структура |
|
| Плотность |
1.046g/cm3 |
| Точка кипения |
288.7°C at 760 mmHg |
| Показатель преломления |
1.509 |
| Температура вспышки |
118.1°C |
| Символы опасности |
 C:Corrosive;
|
| Риск коды |
R34:Causes burns.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
