ChemNet > CAS > 35213-00-4 2,6-Dinitrobenzonitrile
35213-00-4 2,6-Dinitrobenzonitrile
Название продукта |
2,6-Dinitrobenzonitrile |
Синонимы |
Dinitrobenzonitrile; Benzonitrile, 2,6-dinitro-; 2,3-dinitrobenzonitrile |
Молекулярная формула |
C7H3N3O4 |
Молекулярный вес |
193.1164 |
InChI |
InChI=1/C7H3N3O4/c8-4-5-2-1-3-6(9(11)12)7(5)10(13)14/h1-3H |
Регистрационный номер CAS |
35213-00-4 |
Молекулярная структура |
|
Плотность |
1.555g/cm3 |
Точка кипения |
387.959°C at 760 mmHg |
Показатель преломления |
1.616 |
Температура вспышки |
188.431°C |
Символы опасности |
|
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|