ChemNet > CAS > 35923-79-6 pentafluorophenylisothiocyanate
35923-79-6 pentafluorophenylisothiocyanate
| Название продукта |
pentafluorophenylisothiocyanate |
| Синонимы |
Pentafluorophenyl isothiocyanate; Pentafluoroisothiocyanatobenzene; 1,2,3,4,5-pentafluoro-6-isothiocyanatobenzene |
| Молекулярная формула |
C7F5NS |
| Молекулярный вес |
225.1386 |
| InChI |
InChI=1/C7F5NS/c8-2-3(9)5(11)7(13-1-14)6(12)4(2)10 |
| Регистрационный номер CAS |
35923-79-6 |
| EINECS |
252-791-9 |
| Молекулярная структура |
|
| Плотность |
1.55g/cm3 |
| Точка кипения |
224.3°C at 760 mmHg |
| Показатель преломления |
1.492 |
| Температура вспышки |
89.4°C |
| Символы опасности |
|
| Риск коды |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
