ChemNet > CAS > 394-35-4 methyl 2-fluorobenzoate
394-35-4 methyl 2-fluorobenzoate
| Название продукта |
methyl 2-fluorobenzoate |
| Синонимы |
2-Fluorobenzoic acid methyl ester |
| Молекулярная формула |
C8H7FO2 |
| Молекулярный вес |
154.14 |
| InChI |
InChI=1/C8H7FO2/c1-11-8(10)6-4-2-3-5-7(6)9/h2-5H,1H3 |
| Регистрационный номер CAS |
394-35-4 |
| EINECS |
206-894-0 |
| Молекулярная структура |
|
| Плотность |
1.21 |
| Точка кипения |
99℃ (18 torr) |
| Символы опасности |
|
| Риск коды |
R36/38:Irritating to eyes and skin.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
