CAS No: 3999-42-6, Chemical Name: borane-2,6-lutidine complex
Chemical CAS Database with Global Chemical Suppliers - ChemNet
the physical and chemical property of 3999-42-6, borane-2,6-lutidine complex is provided by ChemNet.com

  ChemNet > CAS > 3999-42-6 borane-2,6-lutidine complex

3999-42-6 borane-2,6-lutidine complex

Название продукта borane-2,6-lutidine complex
Синонимы 2,6-dimethylpyridine-borane
Молекулярная формула C7H12BN
Молекулярный вес 120.98
InChI InChI=1/C7H12BN/c1-6-4-3-5-7(2)9(6)8/h3-5H,1-2,8H3/q+1
Регистрационный номер CAS 3999-42-6
EINECS 223-645-1
Молекулярная структура 3999-42-6 borane-2,6-lutidine complex
Символы опасности
Риск коды
Характеристики безопасности