ChemNet > CAS > 40397-96-4 4-chloro-3-nitrophenyl isocyanate
40397-96-4 4-chloro-3-nitrophenyl isocyanate
| Название продукта |
4-chloro-3-nitrophenyl isocyanate |
| Синонимы |
Isocyanic acid 4-chloro-3-nitrophenyl ester; 4-Chloro-3-nitroisocyanatobenzene; 1-chloro-4-isocyanato-2-nitrobenzene |
| Молекулярная формула |
C7H3ClN2O3 |
| Молекулярный вес |
198.5633 |
| InChI |
InChI=1/C7H3ClN2O3/c8-6-2-1-5(9-4-11)3-7(6)10(12)13/h1-3H |
| Регистрационный номер CAS |
40397-96-4 |
| Молекулярная структура |
|
| Плотность |
1.48g/cm3 |
| Температура плавления |
66-69℃ |
| Точка кипения |
306°C at 760 mmHg |
| Показатель преломления |
1.612 |
| Температура вспышки |
138.9°C |
| Символы опасности |
 T:Toxic;
|
| Риск коды |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R42/43:May cause sensitization by inhalation and skin contact.;
|
| Характеристики безопасности |
S22:Do not inhale dust.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
