ChemNet > CAS > 42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile
42225-04-7 2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile
Название продукта |
2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
Синонимы |
(6S)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile; (6R)-2-amino-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carbonitrile |
Молекулярная формула |
C10H12N2S |
Молекулярный вес |
192.2807 |
InChI |
InChI=1/C10H12N2S/c1-6-2-3-7-8(5-11)10(12)13-9(7)4-6/h6H,2-4,12H2,1H3/t6-/m1/s1 |
Регистрационный номер CAS |
42225-04-7 |
Молекулярная структура |
|
Плотность |
1.22g/cm3 |
Температура плавления |
147℃ |
Точка кипения |
392.8°C at 760 mmHg |
Показатель преломления |
1.607 |
Температура вспышки |
191.4°C |
Символы опасности |
Xn:Harmful;
|
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Характеристики безопасности |
S36/37:Wear suitable protective clothing and gloves.;
|
|