ChemNet > CAS > 42754-62-1 5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
42754-62-1 5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile
| Название продукта |
5-amino-3-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| Синонимы |
3-amino-5-(4-chlorophenyl)-1H-pyrazole-4-carbonitrile |
| Молекулярная формула |
C10H7ClN4 |
| Молекулярный вес |
218.6424 |
| InChI |
InChI=1/C10H7ClN4/c11-7-3-1-6(2-4-7)9-8(5-12)10(13)15-14-9/h1-4H,(H3,13,14,15) |
| Регистрационный номер CAS |
42754-62-1 |
| Молекулярная структура |
|
| Плотность |
1.48g/cm3 |
| Температура плавления |
212℃ |
| Точка кипения |
554.7°C at 760 mmHg |
| Показатель преломления |
1.688 |
| Температура вспышки |
289.3°C |
| Символы опасности |
 Xn:Harmful;
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S36/37:Wear suitable protective clothing and gloves.;
|
|
