ChemNet > CAS > 4472-41-7 N,N-Dimethylformamide-d7
4472-41-7 N,N-Dimethylformamide-d7
| Название продукта |
N,N-Dimethylformamide-d7 |
| Синонимы |
Dimethylformamidedisotopicpurity; N,N-bis[(~2~H_3_)methyl](~2~H)formamide; N,N-bis[(~2~H_3_)methyl]formamide |
| Молекулярная формула |
C3HD6NO |
| Молекулярный вес |
79.1308 |
| InChI |
InChI=1/C3H7NO/c1-4(2)3-5/h3H,1-2H3/i1D3,2D3 |
| Регистрационный номер CAS |
4472-41-7 |
| EINECS |
224-745-8 |
| Молекулярная структура |
|
| Плотность |
0.958g/cm3 |
| Точка кипения |
152.999°C at 760 mmHg |
| Показатель преломления |
1.396 |
| Температура вспышки |
57.778°C |
| Символы опасности |
 T:Toxic;
|
| Риск коды |
R20/21:Harmful by inhalation and in contact with skin.;
R36:Irritating to eyes.;
R61:May cause harm to the unborn child.;
|
| Характеристики безопасности |
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
S53:Avoid exposure - obtain special instructions before use.;
|
|
