ChemNet > CAS > 5266-85-3 2-Methyl-6-isopropylaniline
5266-85-3 2-Methyl-6-isopropylaniline
| Название продукта |
2-Methyl-6-isopropylaniline |
| Синонимы |
2-Methyl-6-(1-methylethyl)benzenamine; 2-Isopropyl-6-methylaniline; 6-isopropyl-o-toluidine; 2-methyl-6-(propan-2-yl)aniline |
| Молекулярная формула |
C10H15N |
| Молекулярный вес |
149.2328 |
| InChI |
InChI=1/C10H15N/c1-7(2)9-6-4-5-8(3)10(9)11/h4-7H,11H2,1-3H3 |
| Регистрационный номер CAS |
5266-85-3 |
| EINECS |
226-083-5 |
| Молекулярная структура |
|
| Плотность |
0.944g/cm3 |
| Точка кипения |
236.2°C at 760 mmHg |
| Показатель преломления |
1.538 |
| Температура вспышки |
97.8°C |
| Символы опасности |
 Xn:Harmful;
|
| Риск коды |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S16:Keep away from sources of ignition - No smoking.;
S24/25:Avoid contact with skin and eyes.;
|
|
