ChemNet > CAS > 5306-96-7 2,3-Dimethyl-p-phenylenediamine
5306-96-7 2,3-Dimethyl-p-phenylenediamine
| Название продукта |
2,3-Dimethyl-p-phenylenediamine |
| Синонимы |
p-Phenylenediamine, 2,3-dimethyl-; 4-Amino-5,6-dimethylaniline; CCRIS 8132; 2,3-dimethylbenzene-1,4-diamine; 1,4-Diamino-2,3-dimethylbenzene |
| Молекулярная формула |
C8H12N2 |
| Молекулярный вес |
136.1943 |
| InChI |
InChI=1/C8H12N2/c1-5-6(2)8(10)4-3-7(5)9/h3-4H,9-10H2,1-2H3 |
| Регистрационный номер CAS |
5306-96-7 |
| Молекулярная структура |
|
| Плотность |
1.076g/cm3 |
| Точка кипения |
288.5°C at 760 mmHg |
| Показатель преломления |
1.618 |
| Температура вспышки |
151.5°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
