ChemNet > CAS > 57264-46-7 2-Chloro-6-methylbenzylamine
57264-46-7 2-Chloro-6-methylbenzylamine
Название продукта |
2-Chloro-6-methylbenzylamine |
Синонимы |
1-(2-chloro-6-methylphenyl)methanamine |
Молекулярная формула |
C8H10ClN |
Молекулярный вес |
155.6247 |
InChI |
InChI=1/C8H10ClN/c1-6-3-2-4-8(9)7(6)5-10/h2-4H,5,10H2,1H3 |
Регистрационный номер CAS |
57264-46-7 |
Молекулярная структура |
|
Плотность |
1.13g/cm3 |
Точка кипения |
242.8°C at 760 mmHg |
Показатель преломления |
1.558 |
Температура вспышки |
115.9°C |
Символы опасности |
|
Риск коды |
R34:Causes burns.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|