ChemNet > CAS > 58880-37-8 1-(4-Chlorophenyl)-1-cyclohexanecarboxylicacid
58880-37-8 1-(4-Chlorophenyl)-1-cyclohexanecarboxylicacid
Название продукта |
1-(4-Chlorophenyl)-1-cyclohexanecarboxylicacid |
Синонимы |
1-(4-Chlorophenyl)cyclohexane-1-carboxylic acid; 1-(4-chlorophenyl)cyclohexanecarboxylic acid; 1-(4-chlorophenyl)cyclohexanecarboxylate |
Молекулярная формула |
C13H14ClO2 |
Молекулярный вес |
237.7026 |
InChI |
InChI=1/C13H15ClO2/c14-11-6-4-10(5-7-11)13(12(15)16)8-2-1-3-9-13/h4-7H,1-3,8-9H2,(H,15,16)/p-1 |
Регистрационный номер CAS |
58880-37-8 |
EINECS |
261-481-2 |
Молекулярная структура |
|
Температура плавления |
150-156℃ |
Точка кипения |
378.9°C at 760 mmHg |
Температура вспышки |
183°C |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|