ChemNet > CAS > 598-38-9 2,2-dichloroethanol
598-38-9 2,2-dichloroethanol
| Название продукта |
2,2-dichloroethanol |
| Синонимы |
2,2-Dichloroethanol; 4-01-00-01383 (Beilstein Handbook Reference); BRN 1731633; Dichloroethanol; NSC 60513; Ethanol, 2,2-dichloro- |
| Молекулярная формула |
C2H4Cl2O |
| Молекулярный вес |
114.9586 |
| InChI |
InChI=1/C2H4Cl2O/c3-2(4)1-5/h2,5H,1H2 |
| Регистрационный номер CAS |
598-38-9 |
| EINECS |
209-931-9 |
| Молекулярная структура |
|
| Плотность |
1.398g/cm3 |
| Точка кипения |
146°C at 760 mmHg |
| Показатель преломления |
1.459 |
| Температура вспышки |
78.3°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R40:Possible risks of irreversible effects.;
|
| Характеристики безопасности |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
