ChemNet > CAS > 626-04-0 benzene-1,3-dithiol
626-04-0 benzene-1,3-dithiol
Название продукта |
benzene-1,3-dithiol |
Синонимы |
1,3-Benzenedithiol; 1,3-Dimercaptobenzene~Dithioresorcinol |
Молекулярная формула |
C6H6S2 |
Молекулярный вес |
142.2418 |
InChI |
InChI=1/C6H6S2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
Регистрационный номер CAS |
626-04-0 |
EINECS |
210-925-3 |
Молекулярная структура |
|
Плотность |
1.24g/cm3 |
Температура плавления |
24-25℃ |
Точка кипения |
244.3°C at 760 mmHg |
Показатель преломления |
1.665 |
Температура вспышки |
112.7°C |
Символы опасности |
|
Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Характеристики безопасности |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|