ChemNet > CAS > 6298-72-2 1,4-bis(chloromethyl)-2,5-dimethylbenzene
6298-72-2 1,4-bis(chloromethyl)-2,5-dimethylbenzene
| Название продукта |
1,4-bis(chloromethyl)-2,5-dimethylbenzene |
| Синонимы |
1,4-Bis(chloromethyl)-2,5-dimethylbenzene; 2,5-Di(Chloromethyl)-p-xylene; benzene, 1,4-bis(chloromethyl)-2,5-dimethyl- |
| Молекулярная формула |
C10H12Cl2 |
| Молекулярный вес |
203.1083 |
| InChI |
InChI=1/C10H12Cl2/c1-7-3-10(6-12)8(2)4-9(7)5-11/h3-4H,5-6H2,1-2H3 |
| Регистрационный номер CAS |
6298-72-2 |
| EINECS |
228-575-5 |
| Молекулярная структура |
|
| Плотность |
1.145g/cm3 |
| Температура плавления |
131.5-132.5℃ |
| Точка кипения |
291.5°C at 760 mmHg |
| Показатель преломления |
1.537 |
| Температура вспышки |
142.2°C |
| Символы опасности |
|
| Риск коды |
R34:Causes burns.;
|
| Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
