ChemNet > CAS > 66424-91-7 5-Methyl-2-nitrobenzyl chloride
66424-91-7 5-Methyl-2-nitrobenzyl chloride
Название продукта |
5-Methyl-2-nitrobenzyl chloride |
Синонимы |
alpha-chloro-5-methyl-2-nitrotoluene; 2-(chloromethyl)-4-methyl-1-nitrobenzene |
Молекулярная формула |
C8H8ClNO2 |
Молекулярный вес |
185.6076 |
InChI |
InChI=1/C8H8ClNO2/c1-6-2-3-8(10(11)12)7(4-6)5-9/h2-4H,5H2,1H3 |
Регистрационный номер CAS |
66424-91-7 |
EINECS |
266-359-2 |
Молекулярная структура |
|
Плотность |
1.277g/cm3 |
Температура плавления |
41-43℃ |
Точка кипения |
292.3°C at 760 mmHg |
Показатель преломления |
1.566 |
Температура вспышки |
130.6°C |
Символы опасности |
C:Corrosive;
|
Риск коды |
R34:Causes burns.;
|
Характеристики безопасности |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|