ChemNet > CAS > 68412-48-6 2-Propanone, reaction products with diphenylamine
68412-48-6 2-Propanone, reaction products with diphenylamine
Название продукта |
2-Propanone, reaction products with diphenylamine |
Синонимы |
Acetone diphenylamine condensation products; Acetone, diphenylamine condensation product; Diphenylamine, acetone reaction product; N-Phenylbenzeneamine, 2-propanone reaction product; propan-2-one-N-cyclohexylcyclohexanamine (1:1); propan-2-one-N-phenylaniline (1:1); Acetone Diphenylamine; Antioxidant BLE; Rubber Antioxidant BLE-W |
Молекулярная формула |
C15H17NO |
Молекулярный вес |
227.3016 |
InChI |
InChI=1/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4/h1-10,13H;1-2H3 |
Регистрационный номер CAS |
68412-48-6 |
EINECS |
270-192-0 |
Молекулярная структура |
|
Точка кипения |
302°C at 760 mmHg |
Температура вспышки |
152.8°C |
Символы опасности |
|
Риск коды |
|
Характеристики безопасности |
|
|