ChemNet > CAS > 6848-13-1 3-Chloro-N,N-dimethylaniline
6848-13-1 3-Chloro-N,N-dimethylaniline
| Название продукта |
3-Chloro-N,N-dimethylaniline |
| Синонимы |
3-Chloro-NN-dimethylaniline |
| Молекулярная формула |
C8H10ClN |
| Молекулярный вес |
155.6247 |
| InChI |
InChI=1/C8H10ClN/c1-10(2)8-5-3-4-7(9)6-8/h3-6H,1-2H3 |
| Регистрационный номер CAS |
6848-13-1 |
| EINECS |
229-935-4 |
| Молекулярная структура |
|
| Плотность |
1.117g/cm3 |
| Точка кипения |
232.663°C at 760 mmHg |
| Показатель преломления |
1.566 |
| Температура вспышки |
94.512°C |
| Символы опасности |
|
| Риск коды |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Характеристики безопасности |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
